glutamic acid


(2S)-2-aminopentanedioic acid; (+)-glutamic acid; glutamic acid; L-glutamic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[617-65-2]
Formula:C5H9NO4; 147.13 g/mol
InChiKey:WHUUTDBJXJRKMK-VKHMYHEASA-N
SMILES:N[C@@H](CCC(O)=O)C(O)=O
Molecular structure of glutamic acid
Density:1.540 g/mL
Molar volume:95.5 mL/mol
Melting point:224 °C
Log10 partition octanol / water:-3.69

Isomers

2-(aminomethyl)butanedioic acid
Molecular structure of 2-(aminomethyl)butanedioic acid
2-aminopentanedioic acid
Molecular structure of 2-aminopentanedioic acid
3-azahexanedioic acid
Molecular structure of 3-azahexanedioic acid
2-(ethoxycarbonylamino)acetic acid
Molecular structure of 2-(ethoxycarbonylamino)acetic acid
ethyl 2-nitropropionate
Molecular structure of ethyl 2-nitropropionate
D-glutamic acid
Molecular structure of D-glutamic acid
glutamic acid
Molecular structure of glutamic acid
N-methylaspartic acid
Molecular structure of N-methylaspartic acid
N-methyliminodiacetic acid
Molecular structure of N-methyliminodiacetic acid
methyl 4-nitrobutanoate
Molecular structure of methyl 4-nitrobutanoate